C34H54GeN2O3 — CID 58671893
[4-[5-(6-triethylgermylhexoxy)pyrimidin-2-yl]phenyl] 4-pentylcyclohexane-1-carboxylate (PubChem CID 58671893) has the molecular formula C34H54GeN2O3 and a molecular weight of 611.43 g/mol. Its IUPAC name is [4-[5-(6-triethylgermylhexoxy)pyrimidin-2-yl]phenyl] 4-pentylcyclohexane-1-carboxylate.
| Compound Name | [4-[5-(6-triethylgermylhexoxy)pyrimidin-2-yl]phenyl] 4-pentylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 58671893 |
| Molecular Formula | C34H54GeN2O3 |
| Molecular Weight | 611.43 g/mol |
| Exact Mass | 612.33 |
| IUPAC Name | [4-[5-(6-triethylgermylhexoxy)pyrimidin-2-yl]phenyl] 4-pentylcyclohexane-1-carboxylate |
| SMILES | CCCCCC1CCC(C(=O)Oc2ccc(-c3ncc(OCCCCCC[Ge](CC)(CC)CC)cn3)cc2)CC1 |
| InChI | InChI=1S/C34H54GeN2O3/c1-5-9-12-15-28-16-18-30(19-17-28)34(38)40-31-22-20-29(21-23-31)33-36-26-32(27-37-33)39-25-14-11-10-13-24-35(6-2,7-3)8-4/h20-23,26-28,30H,5-19,24-25H2,1-4H3 |
| InChIKey | FPUREAISXRKCMV-UHFFFAOYSA-N |
| XLogP | 9.88 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.43 |
| LogP ≤ 5 | 9.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|