C33H44O3 — CID 15745082
[4-(4-octoxyphenyl)phenyl] 4-(4-methylpent-3-enyl)cyclohex-3-ene-1-carboxylate (PubChem CID 15745082) has the molecular formula C33H44O3 and a molecular weight of 488.71 g/mol. Its IUPAC name is [4-(4-octoxyphenyl)phenyl] 4-(4-methylpent-3-enyl)cyclohex-3-ene-1-carboxylate.
| Compound Name | [4-(4-octoxyphenyl)phenyl] 4-(4-methylpent-3-enyl)cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 15745082 |
| Molecular Formula | C33H44O3 |
| Molecular Weight | 488.71 g/mol |
| Exact Mass | 488.33 |
| IUPAC Name | [4-(4-octoxyphenyl)phenyl] 4-(4-methylpent-3-enyl)cyclohex-3-ene-1-carboxylate |
| SMILES | CCCCCCCCOc1ccc(-c2ccc(OC(=O)C3CC=C(CCC=C(C)C)CC3)cc2)cc1 |
| InChI | InChI=1S/C33H44O3/c1-4-5-6-7-8-9-25-35-31-21-17-28(18-22-31)29-19-23-32(24-20-29)36-33(34)30-15-13-27(14-16-30)12-10-11-26(2)3/h11,13,17-24,30H,4-10,12,14-16,25H2,1-3H3 |
| InChIKey | WMHPJVRATJJYED-UHFFFAOYSA-N |
| XLogP | 9.47 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.71 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|