C20H28O3 — CID 14066859
(4-butoxyphenyl) 4-propylcyclohex-3-ene-1-carboxylate (PubChem CID 14066859) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is (4-butoxyphenyl) 4-propylcyclohex-3-ene-1-carboxylate.
| Compound Name | (4-butoxyphenyl) 4-propylcyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 14066859 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | (4-butoxyphenyl) 4-propylcyclohex-3-ene-1-carboxylate |
| SMILES | CCCCOc1ccc(OC(=O)C2CC=C(CCC)CC2)cc1 |
| InChI | InChI=1S/C20H28O3/c1-3-5-15-22-18-11-13-19(14-12-18)23-20(21)17-9-7-16(6-4-2)8-10-17/h7,11-14,17H,3-6,8-10,15H2,1-2H3 |
| InChIKey | ZZCOJVBFHMUNDZ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|