C23H36O5 — CID 18598209
(4-hexoxyphenyl) 2-hexyl-1,3-dioxane-5-carboxylate (PubChem CID 18598209) has the molecular formula C23H36O5 and a molecular weight of 392.54 g/mol. Its IUPAC name is (4-hexoxyphenyl) 2-hexyl-1,3-dioxane-5-carboxylate.
| Compound Name | (4-hexoxyphenyl) 2-hexyl-1,3-dioxane-5-carboxylate |
|---|---|
| PubChem CID | 18598209 |
| Molecular Formula | C23H36O5 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.26 |
| IUPAC Name | (4-hexoxyphenyl) 2-hexyl-1,3-dioxane-5-carboxylate |
| SMILES | CCCCCCOc1ccc(OC(=O)C2COC(CCCCCC)OC2)cc1 |
| InChI | InChI=1S/C23H36O5/c1-3-5-7-9-11-22-26-17-19(18-27-22)23(24)28-21-14-12-20(13-15-21)25-16-10-8-6-4-2/h12-15,19,22H,3-11,16-18H2,1-2H3 |
| InChIKey | FXKJRDNQDSOREB-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|