C19H25NO4 — CID 18598207
(4-cyanophenyl) 2-heptyl-1,3-dioxane-5-carboxylate (PubChem CID 18598207) has the molecular formula C19H25NO4 and a molecular weight of 331.41 g/mol. Its IUPAC name is (4-cyanophenyl) 2-heptyl-1,3-dioxane-5-carboxylate.
| Compound Name | (4-cyanophenyl) 2-heptyl-1,3-dioxane-5-carboxylate |
|---|---|
| PubChem CID | 18598207 |
| Molecular Formula | C19H25NO4 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | (4-cyanophenyl) 2-heptyl-1,3-dioxane-5-carboxylate |
| SMILES | CCCCCCCC1OCC(C(=O)Oc2ccc(C#N)cc2)CO1 |
| InChI | InChI=1S/C19H25NO4/c1-2-3-4-5-6-7-18-22-13-16(14-23-18)19(21)24-17-10-8-15(12-20)9-11-17/h8-11,16,18H,2-7,13-14H2,1H3 |
| InChIKey | SDDQGJXVIHJSFL-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|