C20H27NO4 — CID 70489549
[4-(1-cyanoethyl)phenyl] (4R,5S)-4-hexyl-1,3-dioxane-5-carboxylate (PubChem CID 70489549) has the molecular formula C20H27NO4 and a molecular weight of 345.44 g/mol. Its IUPAC name is [4-(1-cyanoethyl)phenyl] (4R,5S)-4-hexyl-1,3-dioxane-5-carboxylate.
| Compound Name | [4-(1-cyanoethyl)phenyl] (4R,5S)-4-hexyl-1,3-dioxane-5-carboxylate |
|---|---|
| PubChem CID | 70489549 |
| Molecular Formula | C20H27NO4 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | [4-(1-cyanoethyl)phenyl] (4R,5S)-4-hexyl-1,3-dioxane-5-carboxylate |
| SMILES | CCCCCC[C@H]1OCOC[C@@H]1C(=O)Oc1ccc(C(C)C#N)cc1 |
| InChI | InChI=1S/C20H27NO4/c1-3-4-5-6-7-19-18(13-23-14-24-19)20(22)25-17-10-8-16(9-11-17)15(2)12-21/h8-11,15,18-19H,3-7,13-14H2,1-2H3/t15?,18-,19+/m0/s1 |
| InChIKey | ROEBDNXLYIVJQU-AOWWOYQVSA-N |
| XLogP | 4.18 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|