C21H32O3 — CID 70391903
(4-ethoxyphenyl) (1R,2R,4S)-2-methyl-4-pentylcyclohexane-1-carboxylate (PubChem CID 70391903) has the molecular formula C21H32O3 and a molecular weight of 332.48 g/mol. Its IUPAC name is (4-ethoxyphenyl) (1R,2R,4S)-2-methyl-4-pentylcyclohexane-1-carboxylate.
| Compound Name | (4-ethoxyphenyl) (1R,2R,4S)-2-methyl-4-pentylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 70391903 |
| Molecular Formula | C21H32O3 |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | (4-ethoxyphenyl) (1R,2R,4S)-2-methyl-4-pentylcyclohexane-1-carboxylate |
| SMILES | CCCCC[C@H]1CC[C@@H](C(=O)Oc2ccc(OCC)cc2)[C@H](C)C1 |
| InChI | InChI=1S/C21H32O3/c1-4-6-7-8-17-9-14-20(16(3)15-17)21(22)24-19-12-10-18(11-13-19)23-5-2/h10-13,16-17,20H,4-9,14-15H2,1-3H3/t16-,17+,20-/m1/s1 |
| InChIKey | BUHJOHOCQYBTRA-FUHIMQAGSA-N |
| XLogP | 5.62 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|