C24H27NO4 — CID 169302426
[4-(4-cyanophenyl)phenyl] 5-hexyl-1,3-dioxane-2-carboxylate (PubChem CID 169302426) has the molecular formula C24H27NO4 and a molecular weight of 393.48 g/mol. Its IUPAC name is [4-(4-cyanophenyl)phenyl] 5-hexyl-1,3-dioxane-2-carboxylate.
| Compound Name | [4-(4-cyanophenyl)phenyl] 5-hexyl-1,3-dioxane-2-carboxylate |
|---|---|
| PubChem CID | 169302426 |
| Molecular Formula | C24H27NO4 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | [4-(4-cyanophenyl)phenyl] 5-hexyl-1,3-dioxane-2-carboxylate |
| SMILES | CCCCCCC1COC(C(=O)Oc2ccc(-c3ccc(C#N)cc3)cc2)OC1 |
| InChI | InChI=1S/C24H27NO4/c1-2-3-4-5-6-19-16-27-24(28-17-19)23(26)29-22-13-11-21(12-14-22)20-9-7-18(15-25)8-10-20/h7-14,19,24H,2-6,16-17H2,1H3 |
| InChIKey | SSPCLZUBJIWLNM-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|