C23H25NO5 — CID 18598205
(4-cyanophenyl) 2-(4-pentoxyphenyl)-1,3-dioxane-5-carboxylate (PubChem CID 18598205) has the molecular formula C23H25NO5 and a molecular weight of 395.46 g/mol. Its IUPAC name is (4-cyanophenyl) 2-(4-pentoxyphenyl)-1,3-dioxane-5-carboxylate.
| Compound Name | (4-cyanophenyl) 2-(4-pentoxyphenyl)-1,3-dioxane-5-carboxylate |
|---|---|
| PubChem CID | 18598205 |
| Molecular Formula | C23H25NO5 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | (4-cyanophenyl) 2-(4-pentoxyphenyl)-1,3-dioxane-5-carboxylate |
| SMILES | CCCCCOc1ccc(C2OCC(C(=O)Oc3ccc(C#N)cc3)CO2)cc1 |
| InChI | InChI=1S/C23H25NO5/c1-2-3-4-13-26-20-11-7-18(8-12-20)23-27-15-19(16-28-23)22(25)29-21-9-5-17(14-24)6-10-21/h5-12,19,23H,2-4,13,15-16H2,1H3 |
| InChIKey | KFEOYLBYBRJWLV-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 77.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|