C21H23NO6 — CID 18598198
(4-nitrophenyl) 2-(4-butylphenyl)-1,3-dioxane-5-carboxylate (PubChem CID 18598198) has the molecular formula C21H23NO6 and a molecular weight of 385.42 g/mol. Its IUPAC name is (4-nitrophenyl) 2-(4-butylphenyl)-1,3-dioxane-5-carboxylate.
| Compound Name | (4-nitrophenyl) 2-(4-butylphenyl)-1,3-dioxane-5-carboxylate |
|---|---|
| PubChem CID | 18598198 |
| Molecular Formula | C21H23NO6 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | (4-nitrophenyl) 2-(4-butylphenyl)-1,3-dioxane-5-carboxylate |
| SMILES | CCCCc1ccc(C2OCC(C(=O)Oc3ccc([N+](=O)[O-])cc3)CO2)cc1 |
| InChI | InChI=1S/C21H23NO6/c1-2-3-4-15-5-7-16(8-6-15)21-26-13-17(14-27-21)20(23)28-19-11-9-18(10-12-19)22(24)25/h5-12,17,21H,2-4,13-14H2,1H3 |
| InChIKey | MJCQROXWULWQLR-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|