C16H22O4 — CID 174828256
5-(4-pentoxyphenyl)-1,3-dioxane-2-carbaldehyde (PubChem CID 174828256) has the molecular formula C16H22O4 and a molecular weight of 278.35 g/mol. Its IUPAC name is 5-(4-pentoxyphenyl)-1,3-dioxane-2-carbaldehyde.
| Compound Name | 5-(4-pentoxyphenyl)-1,3-dioxane-2-carbaldehyde |
|---|---|
| PubChem CID | 174828256 |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 5-(4-pentoxyphenyl)-1,3-dioxane-2-carbaldehyde |
| SMILES | CCCCCOc1ccc(C2COC(C=O)OC2)cc1 |
| InChI | InChI=1S/C16H22O4/c1-2-3-4-9-18-15-7-5-13(6-8-15)14-11-19-16(10-17)20-12-14/h5-8,10,14,16H,2-4,9,11-12H2,1H3 |
| InChIKey | OXFQVHRSNCELJN-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|