C26H40O5 — CID 91721955
1-O-nonyl 2-O-(4-propan-2-yloxyphenyl) cyclohexane-1,2-dicarboxylate (PubChem CID 91721955) has the molecular formula C26H40O5 and a molecular weight of 432.60 g/mol. Its IUPAC name is 1-O-nonyl 2-O-(4-propan-2-yloxyphenyl) cyclohexane-1,2-dicarboxylate.
| Compound Name | 1-O-nonyl 2-O-(4-propan-2-yloxyphenyl) cyclohexane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 91721955 |
| Molecular Formula | C26H40O5 |
| Molecular Weight | 432.60 g/mol |
| Exact Mass | 432.29 |
| IUPAC Name | 1-O-nonyl 2-O-(4-propan-2-yloxyphenyl) cyclohexane-1,2-dicarboxylate |
| SMILES | CCCCCCCCCOC(=O)C1CCCCC1C(=O)Oc1ccc(OC(C)C)cc1 |
| InChI | InChI=1S/C26H40O5/c1-4-5-6-7-8-9-12-19-29-25(27)23-13-10-11-14-24(23)26(28)31-22-17-15-21(16-18-22)30-20(2)3/h15-18,20,23-24H,4-14,19H2,1-3H3 |
| InChIKey | MTDUZCPRZMIQST-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.60 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|