C22H32O5 — CID 91722003
1-O-heptyl 2-O-(4-methoxyphenyl) cyclohexane-1,2-dicarboxylate (PubChem CID 91722003) has the molecular formula C22H32O5 and a molecular weight of 376.49 g/mol. Its IUPAC name is 1-O-heptyl 2-O-(4-methoxyphenyl) cyclohexane-1,2-dicarboxylate.
| Compound Name | 1-O-heptyl 2-O-(4-methoxyphenyl) cyclohexane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 91722003 |
| Molecular Formula | C22H32O5 |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | 1-O-heptyl 2-O-(4-methoxyphenyl) cyclohexane-1,2-dicarboxylate |
| SMILES | CCCCCCCOC(=O)C1CCCCC1C(=O)Oc1ccc(OC)cc1 |
| InChI | InChI=1S/C22H32O5/c1-3-4-5-6-9-16-26-21(23)19-10-7-8-11-20(19)22(24)27-18-14-12-17(25-2)13-15-18/h12-15,19-20H,3-11,16H2,1-2H3 |
| InChIKey | BIROOVPAKYONCK-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|