C18H23NO4 — CID 54365823
(4-cyano-2-methylphenyl) 2-pentyl-1,3-dioxane-5-carboxylate (PubChem CID 54365823) has the molecular formula C18H23NO4 and a molecular weight of 317.38 g/mol. Its IUPAC name is (4-cyano-2-methylphenyl) 2-pentyl-1,3-dioxane-5-carboxylate.
| Compound Name | (4-cyano-2-methylphenyl) 2-pentyl-1,3-dioxane-5-carboxylate |
|---|---|
| PubChem CID | 54365823 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | (4-cyano-2-methylphenyl) 2-pentyl-1,3-dioxane-5-carboxylate |
| SMILES | CCCCCC1OCC(C(=O)Oc2ccc(C#N)cc2C)CO1 |
| InChI | InChI=1S/C18H23NO4/c1-3-4-5-6-17-21-11-15(12-22-17)18(20)23-16-8-7-14(10-19)9-13(16)2/h7-9,15,17H,3-6,11-12H2,1-2H3 |
| InChIKey | UPRYKHGMNKRMNB-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|