C19H28O4 — CID 54243227
(4-ethyl-2-methylphenyl) 2-pentyl-1,3-dioxane-5-carboxylate (PubChem CID 54243227) has the molecular formula C19H28O4 and a molecular weight of 320.43 g/mol. Its IUPAC name is (4-ethyl-2-methylphenyl) 2-pentyl-1,3-dioxane-5-carboxylate.
| Compound Name | (4-ethyl-2-methylphenyl) 2-pentyl-1,3-dioxane-5-carboxylate |
|---|---|
| PubChem CID | 54243227 |
| Molecular Formula | C19H28O4 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | (4-ethyl-2-methylphenyl) 2-pentyl-1,3-dioxane-5-carboxylate |
| SMILES | CCCCCC1OCC(C(=O)Oc2ccc(CC)cc2C)CO1 |
| InChI | InChI=1S/C19H28O4/c1-4-6-7-8-18-21-12-16(13-22-18)19(20)23-17-10-9-15(5-2)11-14(17)3/h9-11,16,18H,4-8,12-13H2,1-3H3 |
| InChIKey | QRLULOVIKPRCNB-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|