C27H36O4 — CID 19069952
(4-decoxyphenyl) 6-hydroxy-1,2,3,4-tetrahydronaphthalene-2-carboxylate (PubChem CID 19069952) has the molecular formula C27H36O4 and a molecular weight of 424.58 g/mol. Its IUPAC name is (4-decoxyphenyl) 6-hydroxy-1,2,3,4-tetrahydronaphthalene-2-carboxylate.
| Compound Name | (4-decoxyphenyl) 6-hydroxy-1,2,3,4-tetrahydronaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 19069952 |
| Molecular Formula | C27H36O4 |
| Molecular Weight | 424.58 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | (4-decoxyphenyl) 6-hydroxy-1,2,3,4-tetrahydronaphthalene-2-carboxylate |
| SMILES | CCCCCCCCCCOc1ccc(OC(=O)C2CCc3cc(O)ccc3C2)cc1 |
| InChI | InChI=1S/C27H36O4/c1-2-3-4-5-6-7-8-9-18-30-25-14-16-26(17-15-25)31-27(29)23-11-10-22-20-24(28)13-12-21(22)19-23/h12-17,20,23,28H,2-11,18-19H2,1H3 |
| InChIKey | KXYQAMIPTYHHBL-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.58 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|