C38H49F3O5 — CID 139654140
[(2R)-1,1,1-trifluorooctan-2-yl] 6-[3-(4-decoxyphenyl)prop-2-ynoyloxy]-1,2,3,4-tetrahydronaphthalene-2-carboxylate (PubChem CID 139654140) has the molecular formula C38H49F3O5 and a molecular weight of 642.80 g/mol. Its IUPAC name is [(2R)-1,1,1-trifluorooctan-2-yl] 6-[3-(4-decoxyphenyl)prop-2-ynoyloxy]-1,2,3,4-tetrahydronaphthalene-2-carboxylate.
| Compound Name | [(2R)-1,1,1-trifluorooctan-2-yl] 6-[3-(4-decoxyphenyl)prop-2-ynoyloxy]-1,2,3,4-tetrahydronaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 139654140 |
| Molecular Formula | C38H49F3O5 |
| Molecular Weight | 642.80 g/mol |
| Exact Mass | 642.35 |
| IUPAC Name | [(2R)-1,1,1-trifluorooctan-2-yl] 6-[3-(4-decoxyphenyl)prop-2-ynoyloxy]-1,2,3,4-tetrahydronaphthalene-2-carboxylate |
| SMILES | CCCCCCCCCCOc1ccc(C#CC(=O)Oc2ccc3c(c2)CCC(C(=O)O[C@H](CCCCCC)C(F)(F)F)C3)cc1 |
| InChI | InChI=1S/C38H49F3O5/c1-3-5-7-9-10-11-12-14-26-44-33-22-16-29(17-23-33)18-25-36(42)45-34-24-21-30-27-32(20-19-31(30)28-34)37(43)46-35(38(39,40)41)15-13-8-6-4-2/h16-17,21-24,28,32,35H,3-15,19-20,26-27H2,1-2H3/t32?,35-/m1/s1 |
| InChIKey | NCQKCUTYMVUQEH-IJLUWNCYSA-N |
| XLogP | 9.71 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.80 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|