C33H38O5 — CID 67617221
6-[4-[4-[(6R)-6-methyloctoxy]phenyl]benzoyl]oxy-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid (PubChem CID 67617221) has the molecular formula C33H38O5 and a molecular weight of 514.66 g/mol. Its IUPAC name is 6-[4-[4-[(6R)-6-methyloctoxy]phenyl]benzoyl]oxy-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid.
| Compound Name | 6-[4-[4-[(6R)-6-methyloctoxy]phenyl]benzoyl]oxy-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 67617221 |
| Molecular Formula | C33H38O5 |
| Molecular Weight | 514.66 g/mol |
| Exact Mass | 514.27 |
| IUPAC Name | 6-[4-[4-[(6R)-6-methyloctoxy]phenyl]benzoyl]oxy-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid |
| SMILES | CC[C@@H](C)CCCCCOc1ccc(-c2ccc(C(=O)Oc3ccc4c(c3)CCC(C(=O)O)C4)cc2)cc1 |
| InChI | InChI=1S/C33H38O5/c1-3-23(2)7-5-4-6-20-37-30-17-14-25(15-18-30)24-8-10-26(11-9-24)33(36)38-31-19-16-27-21-29(32(34)35)13-12-28(27)22-31/h8-11,14-19,22-23,29H,3-7,12-13,20-21H2,1-2H3,(H,34,35)/t23-,29?/m1/s1 |
| InChIKey | QLFAFKRDVUVUSU-WIZGVZBGSA-N |
| XLogP | 7.75 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.66 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|