C34H42O4 — CID 19070004
6-[[4-(4-decoxyphenyl)phenyl]methoxy]-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid (PubChem CID 19070004) has the molecular formula C34H42O4 and a molecular weight of 514.71 g/mol. Its IUPAC name is 6-[[4-(4-decoxyphenyl)phenyl]methoxy]-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid.
| Compound Name | 6-[[4-(4-decoxyphenyl)phenyl]methoxy]-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 19070004 |
| Molecular Formula | C34H42O4 |
| Molecular Weight | 514.71 g/mol |
| Exact Mass | 514.31 |
| IUPAC Name | 6-[[4-(4-decoxyphenyl)phenyl]methoxy]-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid |
| SMILES | CCCCCCCCCCOc1ccc(-c2ccc(COc3ccc4c(c3)CCC(C(=O)O)C4)cc2)cc1 |
| InChI | InChI=1S/C34H42O4/c1-2-3-4-5-6-7-8-9-22-37-32-19-16-28(17-20-32)27-12-10-26(11-13-27)25-38-33-21-18-29-23-31(34(35)36)15-14-30(29)24-33/h10-13,16-21,24,31H,2-9,14-15,22-23,25H2,1H3,(H,35,36) |
| InChIKey | ZEVDUONIIFCYQD-UHFFFAOYSA-N |
| XLogP | 8.64 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.71 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|