C32H41FO4 — CID 88500997
(2S)-2-fluoro-3-methylbutanoic acid;1-octoxy-4-[(4-phenylphenoxy)methyl]benzene (PubChem CID 88500997) has the molecular formula C32H41FO4 and a molecular weight of 508.67 g/mol. Its IUPAC name is (2S)-2-fluoro-3-methylbutanoic acid;1-octoxy-4-[(4-phenylphenoxy)methyl]benzene.
| Compound Name | (2S)-2-fluoro-3-methylbutanoic acid;1-octoxy-4-[(4-phenylphenoxy)methyl]benzene |
|---|---|
| PubChem CID | 88500997 |
| Molecular Formula | C32H41FO4 |
| Molecular Weight | 508.67 g/mol |
| Exact Mass | 508.30 |
| IUPAC Name | (2S)-2-fluoro-3-methylbutanoic acid;1-octoxy-4-[(4-phenylphenoxy)methyl]benzene |
| SMILES | CC(C)[C@H](F)C(=O)O.CCCCCCCCOc1ccc(COc2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C27H32O2.C5H9FO2/c1-2-3-4-5-6-10-21-28-26-17-13-23(14-18-26)22-29-27-19-15-25(16-20-27)24-11-8-7-9-12-24;1-3(2)4(6)5(7)8/h7-9,11-20H,2-6,10,21-22H2,1H3;3-4H,1-2H3,(H,7,8)/t;4-/m.0/s1 |
| InChIKey | QXZNZJGYFQBJEK-VWMHFEHESA-N |
| XLogP | 8.74 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.67 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|