C40H47F3O5 — CID 18397092
[(2R)-1,1,1-trifluorohexan-2-yl] 6-[4-(4-decoxyphenyl)benzoyl]oxy-3,4-dihydronaphthalene-2-carboxylate (PubChem CID 18397092) has the molecular formula C40H47F3O5 and a molecular weight of 664.81 g/mol. Its IUPAC name is [(2R)-1,1,1-trifluorohexan-2-yl] 6-[4-(4-decoxyphenyl)benzoyl]oxy-3,4-dihydronaphthalene-2-carboxylate.
| Compound Name | [(2R)-1,1,1-trifluorohexan-2-yl] 6-[4-(4-decoxyphenyl)benzoyl]oxy-3,4-dihydronaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 18397092 |
| Molecular Formula | C40H47F3O5 |
| Molecular Weight | 664.81 g/mol |
| Exact Mass | 664.34 |
| IUPAC Name | [(2R)-1,1,1-trifluorohexan-2-yl] 6-[4-(4-decoxyphenyl)benzoyl]oxy-3,4-dihydronaphthalene-2-carboxylate |
| SMILES | CCCCCCCCCCOc1ccc(-c2ccc(C(=O)Oc3ccc4c(c3)CCC(C(=O)O[C@H](CCCC)C(F)(F)F)=C4)cc2)cc1 |
| InChI | InChI=1S/C40H47F3O5/c1-3-5-7-8-9-10-11-12-26-46-35-23-20-30(21-24-35)29-14-16-31(17-15-29)38(44)47-36-25-22-32-27-34(19-18-33(32)28-36)39(45)48-37(13-6-4-2)40(41,42)43/h14-17,20-25,27-28,37H,3-13,18-19,26H2,1-2H3/t37-/m1/s1 |
| InChIKey | NQZMSRBGEAVHBO-DIPNUNPCSA-N |
| XLogP | 11.09 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.81 |
| LogP ≤ 5 | 11.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|