C33H39F3N2O5 — CID 139608316
[(2S)-1,1,1-trifluorohexan-2-yl] 2-methyl-4-[4-(5-octoxypyrimidin-2-yl)benzoyl]oxybenzoate (PubChem CID 139608316) has the molecular formula C33H39F3N2O5 and a molecular weight of 600.68 g/mol. Its IUPAC name is [(2S)-1,1,1-trifluorohexan-2-yl] 2-methyl-4-[4-(5-octoxypyrimidin-2-yl)benzoyl]oxybenzoate.
| Compound Name | [(2S)-1,1,1-trifluorohexan-2-yl] 2-methyl-4-[4-(5-octoxypyrimidin-2-yl)benzoyl]oxybenzoate |
|---|---|
| PubChem CID | 139608316 |
| Molecular Formula | C33H39F3N2O5 |
| Molecular Weight | 600.68 g/mol |
| Exact Mass | 600.28 |
| IUPAC Name | [(2S)-1,1,1-trifluorohexan-2-yl] 2-methyl-4-[4-(5-octoxypyrimidin-2-yl)benzoyl]oxybenzoate |
| SMILES | CCCCCCCCOc1cnc(-c2ccc(C(=O)Oc3ccc(C(=O)O[C@@H](CCCC)C(F)(F)F)c(C)c3)cc2)nc1 |
| InChI | InChI=1S/C33H39F3N2O5/c1-4-6-8-9-10-11-19-41-27-21-37-30(38-22-27)24-13-15-25(16-14-24)31(39)42-26-17-18-28(23(3)20-26)32(40)43-29(12-7-5-2)33(34,35)36/h13-18,20-22,29H,4-12,19H2,1-3H3/t29-/m0/s1 |
| InChIKey | MCZDXLJTWQGKOH-LJAQVGFWSA-N |
| XLogP | 8.69 |
| TPSA | 87.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.68 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|