C23H24O4 — CID 59695922
(4-prop-2-enoylphenyl) 6-propoxy-1,2,3,4-tetrahydronaphthalene-2-carboxylate (PubChem CID 59695922) has the molecular formula C23H24O4 and a molecular weight of 364.44 g/mol. Its IUPAC name is (4-prop-2-enoylphenyl) 6-propoxy-1,2,3,4-tetrahydronaphthalene-2-carboxylate.
| Compound Name | (4-prop-2-enoylphenyl) 6-propoxy-1,2,3,4-tetrahydronaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 59695922 |
| Molecular Formula | C23H24O4 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | (4-prop-2-enoylphenyl) 6-propoxy-1,2,3,4-tetrahydronaphthalene-2-carboxylate |
| SMILES | C=CC(=O)c1ccc(OC(=O)C2CCc3cc(OCCC)ccc3C2)cc1 |
| InChI | InChI=1S/C23H24O4/c1-3-13-26-21-12-9-17-14-19(6-5-18(17)15-21)23(25)27-20-10-7-16(8-11-20)22(24)4-2/h4,7-12,15,19H,2-3,5-6,13-14H2,1H3 |
| InChIKey | DAQZYIXWVYWKII-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|