C32H32O2 — CID 59695813
1-[4-[4-[2-(6-pentoxy-5,6,7,8-tetrahydronaphthalen-2-yl)ethynyl]phenyl]phenyl]prop-2-en-1-one (PubChem CID 59695813) has the molecular formula C32H32O2 and a molecular weight of 448.61 g/mol. Its IUPAC name is 1-[4-[4-[2-(6-pentoxy-5,6,7,8-tetrahydronaphthalen-2-yl)ethynyl]phenyl]phenyl]prop-2-en-1-one.
| Compound Name | 1-[4-[4-[2-(6-pentoxy-5,6,7,8-tetrahydronaphthalen-2-yl)ethynyl]phenyl]phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 59695813 |
| Molecular Formula | C32H32O2 |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | 1-[4-[4-[2-(6-pentoxy-5,6,7,8-tetrahydronaphthalen-2-yl)ethynyl]phenyl]phenyl]prop-2-en-1-one |
| SMILES | C=CC(=O)c1ccc(-c2ccc(C#Cc3ccc4c(c3)CCC(OCCCCC)C4)cc2)cc1 |
| InChI | InChI=1S/C32H32O2/c1-3-5-6-21-34-31-20-19-29-22-25(11-14-30(29)23-31)8-7-24-9-12-26(13-10-24)27-15-17-28(18-16-27)32(33)4-2/h4,9-18,22,31H,2-3,5-6,19-21,23H2,1H3 |
| InChIKey | LJLYAXJQPPKHHE-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|