C35H42O5 — CID 67685261
(4-phenylmethoxycarbonylphenyl) 6-decoxy-5,6,7,8-tetrahydronaphthalene-2-carboxylate (PubChem CID 67685261) has the molecular formula C35H42O5 and a molecular weight of 542.72 g/mol. Its IUPAC name is (4-phenylmethoxycarbonylphenyl) 6-decoxy-5,6,7,8-tetrahydronaphthalene-2-carboxylate.
| Compound Name | (4-phenylmethoxycarbonylphenyl) 6-decoxy-5,6,7,8-tetrahydronaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 67685261 |
| Molecular Formula | C35H42O5 |
| Molecular Weight | 542.72 g/mol |
| Exact Mass | 542.30 |
| IUPAC Name | (4-phenylmethoxycarbonylphenyl) 6-decoxy-5,6,7,8-tetrahydronaphthalene-2-carboxylate |
| SMILES | CCCCCCCCCCOC1CCc2cc(C(=O)Oc3ccc(C(=O)OCc4ccccc4)cc3)ccc2C1 |
| InChI | InChI=1S/C35H42O5/c1-2-3-4-5-6-7-8-12-23-38-33-22-19-29-24-31(16-15-30(29)25-33)35(37)40-32-20-17-28(18-21-32)34(36)39-26-27-13-10-9-11-14-27/h9-11,13-18,20-21,24,33H,2-8,12,19,22-23,25-26H2,1H3 |
| InChIKey | KATHNSLXPBBTJS-UHFFFAOYSA-N |
| XLogP | 8.28 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.72 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|