C39H46O7 — CID 67617165
1-[6-(4-decoxybenzoyl)oxy-5,6,7,8-tetrahydronaphthalene-2-carbonyl]oxy-5,6,7,8-tetrahydronaphthalene-2-carboxylic acid (PubChem CID 67617165) has the molecular formula C39H46O7 and a molecular weight of 626.79 g/mol. Its IUPAC name is 1-[6-(4-decoxybenzoyl)oxy-5,6,7,8-tetrahydronaphthalene-2-carbonyl]oxy-5,6,7,8-tetrahydronaphthalene-2-carboxylic acid.
| Compound Name | 1-[6-(4-decoxybenzoyl)oxy-5,6,7,8-tetrahydronaphthalene-2-carbonyl]oxy-5,6,7,8-tetrahydronaphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 67617165 |
| Molecular Formula | C39H46O7 |
| Molecular Weight | 626.79 g/mol |
| Exact Mass | 626.32 |
| IUPAC Name | 1-[6-(4-decoxybenzoyl)oxy-5,6,7,8-tetrahydronaphthalene-2-carbonyl]oxy-5,6,7,8-tetrahydronaphthalene-2-carboxylic acid |
| SMILES | CCCCCCCCCCOc1ccc(C(=O)OC2CCc3cc(C(=O)Oc4c(C(=O)O)ccc5c4CCCC5)ccc3C2)cc1 |
| InChI | InChI=1S/C39H46O7/c1-2-3-4-5-6-7-8-11-24-44-32-20-16-28(17-21-32)38(42)45-33-22-18-29-25-31(15-14-30(29)26-33)39(43)46-36-34-13-10-9-12-27(34)19-23-35(36)37(40)41/h14-17,19-21,23,25,33H,2-13,18,22,24,26H2,1H3,(H,40,41) |
| InChIKey | KWCMMMXPMBYTSR-UHFFFAOYSA-N |
| XLogP | 8.72 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.79 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|