C34H38O5 — CID 23297278
4-[4-(6-decanoyl-1,2,3,4-tetrahydronaphthalene-2-carbonyl)oxyphenyl]benzoic acid (PubChem CID 23297278) has the molecular formula C34H38O5 and a molecular weight of 526.67 g/mol. Its IUPAC name is 4-[4-(6-decanoyl-1,2,3,4-tetrahydronaphthalene-2-carbonyl)oxyphenyl]benzoic acid.
| Compound Name | 4-[4-(6-decanoyl-1,2,3,4-tetrahydronaphthalene-2-carbonyl)oxyphenyl]benzoic acid |
|---|---|
| PubChem CID | 23297278 |
| Molecular Formula | C34H38O5 |
| Molecular Weight | 526.67 g/mol |
| Exact Mass | 526.27 |
| IUPAC Name | 4-[4-(6-decanoyl-1,2,3,4-tetrahydronaphthalene-2-carbonyl)oxyphenyl]benzoic acid |
| SMILES | CCCCCCCCCC(=O)c1ccc2c(c1)CCC(C(=O)Oc1ccc(-c3ccc(C(=O)O)cc3)cc1)C2 |
| InChI | InChI=1S/C34H38O5/c1-2-3-4-5-6-7-8-9-32(35)29-16-14-28-23-30(17-15-27(28)22-29)34(38)39-31-20-18-25(19-21-31)24-10-12-26(13-11-24)33(36)37/h10-14,16,18-22,30H,2-9,15,17,23H2,1H3,(H,36,37) |
| InChIKey | YCMIYYJWQVCTNU-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.67 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|