C19H28O — CID 65449682
1-(5,6,7,8-tetrahydronaphthalen-2-yl)nonan-1-one (PubChem CID 65449682) has the molecular formula C19H28O and a molecular weight of 272.43 g/mol. Its IUPAC name is 1-(5,6,7,8-tetrahydronaphthalen-2-yl)nonan-1-one.
| Compound Name | 1-(5,6,7,8-tetrahydronaphthalen-2-yl)nonan-1-one |
|---|---|
| PubChem CID | 65449682 |
| Molecular Formula | C19H28O |
| Molecular Weight | 272.43 g/mol |
| Exact Mass | 272.21 |
| IUPAC Name | 1-(5,6,7,8-tetrahydronaphthalen-2-yl)nonan-1-one |
| SMILES | CCCCCCCCC(=O)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C19H28O/c1-2-3-4-5-6-7-12-19(20)18-14-13-16-10-8-9-11-17(16)15-18/h13-15H,2-12H2,1H3 |
| InChIKey | ZATANFSTRCXTRY-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.43 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|