C16H23NO — CID 116554411
1-(1,2,3,4-tetrahydroquinolin-6-yl)heptan-1-one (PubChem CID 116554411) has the molecular formula C16H23NO and a molecular weight of 245.37 g/mol. Its IUPAC name is 1-(1,2,3,4-tetrahydroquinolin-6-yl)heptan-1-one.
| Compound Name | 1-(1,2,3,4-tetrahydroquinolin-6-yl)heptan-1-one |
|---|---|
| PubChem CID | 116554411 |
| Molecular Formula | C16H23NO |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | 1-(1,2,3,4-tetrahydroquinolin-6-yl)heptan-1-one |
| SMILES | CCCCCCC(=O)c1ccc2c(c1)CCCN2 |
| InChI | InChI=1S/C16H23NO/c1-2-3-4-5-8-16(18)14-9-10-15-13(12-14)7-6-11-17-15/h9-10,12,17H,2-8,11H2,1H3 |
| InChIKey | ZUEMALOAGCFFQU-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|