C18H27NO — CID 82101388
2-(hexylamino)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethanone (PubChem CID 82101388) has the molecular formula C18H27NO and a molecular weight of 273.42 g/mol. Its IUPAC name is 2-(hexylamino)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethanone.
| Compound Name | 2-(hexylamino)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethanone |
|---|---|
| PubChem CID | 82101388 |
| Molecular Formula | C18H27NO |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.21 |
| IUPAC Name | 2-(hexylamino)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethanone |
| SMILES | CCCCCCNCC(=O)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C18H27NO/c1-2-3-4-7-12-19-14-18(20)17-11-10-15-8-5-6-9-16(15)13-17/h10-11,13,19H,2-9,12,14H2,1H3 |
| InChIKey | RXSLGKXHIQXXTM-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|