C19H31NO4 — CID 3026301
1-(3,4-dihydroxyphenyl)-2-(3-octoxypropylamino)ethanone (PubChem CID 3026301) has the molecular formula C19H31NO4 and a molecular weight of 337.46 g/mol. Its IUPAC name is 1-(3,4-dihydroxyphenyl)-2-(3-octoxypropylamino)ethanone.
| Compound Name | 1-(3,4-dihydroxyphenyl)-2-(3-octoxypropylamino)ethanone |
|---|---|
| PubChem CID | 3026301 |
| Molecular Formula | C19H31NO4 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.23 |
| IUPAC Name | 1-(3,4-dihydroxyphenyl)-2-(3-octoxypropylamino)ethanone |
| SMILES | CCCCCCCCOCCCNCC(=O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C19H31NO4/c1-2-3-4-5-6-7-12-24-13-8-11-20-15-19(23)16-9-10-17(21)18(22)14-16/h9-10,14,20-22H,2-8,11-13,15H2,1H3 |
| InChIKey | OCYHKHDPZQADEQ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|