C18H29NO4 — CID 3026300
1-(3,4-dihydroxyphenyl)-2-(2-octoxyethylamino)ethanone (PubChem CID 3026300) has the molecular formula C18H29NO4 and a molecular weight of 323.43 g/mol. Its IUPAC name is 1-(3,4-dihydroxyphenyl)-2-(2-octoxyethylamino)ethanone.
| Compound Name | 1-(3,4-dihydroxyphenyl)-2-(2-octoxyethylamino)ethanone |
|---|---|
| PubChem CID | 3026300 |
| Molecular Formula | C18H29NO4 |
| Molecular Weight | 323.43 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | 1-(3,4-dihydroxyphenyl)-2-(2-octoxyethylamino)ethanone |
| SMILES | CCCCCCCCOCCNCC(=O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C18H29NO4/c1-2-3-4-5-6-7-11-23-12-10-19-14-18(22)15-8-9-16(20)17(21)13-15/h8-9,13,19-21H,2-7,10-12,14H2,1H3 |
| InChIKey | FDXRGSXLFCWZSG-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.43 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|