C28H38O2 — CID 20500099
[4-(6-butyl-5,6,7,8-tetrahydronaphthalen-2-yl)phenyl] octanoate (PubChem CID 20500099) has the molecular formula C28H38O2 and a molecular weight of 406.61 g/mol. Its IUPAC name is [4-(6-butyl-5,6,7,8-tetrahydronaphthalen-2-yl)phenyl] octanoate.
| Compound Name | [4-(6-butyl-5,6,7,8-tetrahydronaphthalen-2-yl)phenyl] octanoate |
|---|---|
| PubChem CID | 20500099 |
| Molecular Formula | C28H38O2 |
| Molecular Weight | 406.61 g/mol |
| Exact Mass | 406.29 |
| IUPAC Name | [4-(6-butyl-5,6,7,8-tetrahydronaphthalen-2-yl)phenyl] octanoate |
| SMILES | CCCCCCCC(=O)Oc1ccc(-c2ccc3c(c2)CCC(CCCC)C3)cc1 |
| InChI | InChI=1S/C28H38O2/c1-3-5-7-8-9-11-28(29)30-27-18-16-23(17-19-27)25-15-14-24-20-22(10-6-4-2)12-13-26(24)21-25/h14-19,21-22H,3-13,20H2,1-2H3 |
| InChIKey | UMNWSHRCADGXCJ-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.61 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|