C25H32O2 — CID 20500513
[4-[6-(2-methylbutyl)-5,6,7,8-tetrahydronaphthalen-2-yl]phenyl] butanoate (PubChem CID 20500513) has the molecular formula C25H32O2 and a molecular weight of 364.53 g/mol. Its IUPAC name is [4-[6-(2-methylbutyl)-5,6,7,8-tetrahydronaphthalen-2-yl]phenyl] butanoate.
| Compound Name | [4-[6-(2-methylbutyl)-5,6,7,8-tetrahydronaphthalen-2-yl]phenyl] butanoate |
|---|---|
| PubChem CID | 20500513 |
| Molecular Formula | C25H32O2 |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | [4-[6-(2-methylbutyl)-5,6,7,8-tetrahydronaphthalen-2-yl]phenyl] butanoate |
| SMILES | CCCC(=O)Oc1ccc(-c2ccc3c(c2)CCC(CC(C)CC)C3)cc1 |
| InChI | InChI=1S/C25H32O2/c1-4-6-25(26)27-24-13-11-20(12-14-24)22-10-9-21-16-19(15-18(3)5-2)7-8-23(21)17-22/h9-14,17-19H,4-8,15-16H2,1-3H3 |
| InChIKey | VXWIHXROSAJWPC-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|