C26H32O — CID 139852890
6-[4-[(E)-pent-3-enoxy]phenyl]-2-[(E)-pent-3-enyl]-1,2,3,4-tetrahydronaphthalene (PubChem CID 139852890) has the molecular formula C26H32O and a molecular weight of 360.54 g/mol. Its IUPAC name is 6-[4-[(E)-pent-3-enoxy]phenyl]-2-[(E)-pent-3-enyl]-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 6-[4-[(E)-pent-3-enoxy]phenyl]-2-[(E)-pent-3-enyl]-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 139852890 |
| Molecular Formula | C26H32O |
| Molecular Weight | 360.54 g/mol |
| Exact Mass | 360.25 |
| IUPAC Name | 6-[4-[(E)-pent-3-enoxy]phenyl]-2-[(E)-pent-3-enyl]-1,2,3,4-tetrahydronaphthalene |
| SMILES | C/C=C/CCOc1ccc(-c2ccc3c(c2)CCC(CC/C=C/C)C3)cc1 |
| InChI | InChI=1S/C26H32O/c1-3-5-7-9-21-10-11-25-20-24(13-12-23(25)19-21)22-14-16-26(17-15-22)27-18-8-6-4-2/h3-6,12-17,20-21H,7-11,18-19H2,1-2H3/b5-3+,6-4+ |
| InChIKey | HHEVEMNXWGGREI-GGWOSOGESA-N |
| XLogP | 7.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.54 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|