C22H26O — CID 139853661
2-but-3-enyl-6-(4-ethoxyphenyl)-1,2,3,4-tetrahydronaphthalene (PubChem CID 139853661) has the molecular formula C22H26O and a molecular weight of 306.45 g/mol. Its IUPAC name is 2-but-3-enyl-6-(4-ethoxyphenyl)-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 2-but-3-enyl-6-(4-ethoxyphenyl)-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 139853661 |
| Molecular Formula | C22H26O |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.20 |
| IUPAC Name | 2-but-3-enyl-6-(4-ethoxyphenyl)-1,2,3,4-tetrahydronaphthalene |
| SMILES | C=CCCC1CCc2cc(-c3ccc(OCC)cc3)ccc2C1 |
| InChI | InChI=1S/C22H26O/c1-3-5-6-17-7-8-21-16-20(10-9-19(21)15-17)18-11-13-22(14-12-18)23-4-2/h3,9-14,16-17H,1,4-8,15H2,2H3 |
| InChIKey | DTZXYRDVELMNDU-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|