C27H36O2 — CID 20500685
[4-(6-pentyl-5,6,7,8-tetrahydronaphthalen-2-yl)phenyl] hexanoate (PubChem CID 20500685) has the molecular formula C27H36O2 and a molecular weight of 392.58 g/mol. Its IUPAC name is [4-(6-pentyl-5,6,7,8-tetrahydronaphthalen-2-yl)phenyl] hexanoate.
| Compound Name | [4-(6-pentyl-5,6,7,8-tetrahydronaphthalen-2-yl)phenyl] hexanoate |
|---|---|
| PubChem CID | 20500685 |
| Molecular Formula | C27H36O2 |
| Molecular Weight | 392.58 g/mol |
| Exact Mass | 392.27 |
| IUPAC Name | [4-(6-pentyl-5,6,7,8-tetrahydronaphthalen-2-yl)phenyl] hexanoate |
| SMILES | CCCCCC(=O)Oc1ccc(-c2ccc3c(c2)CCC(CCCCC)C3)cc1 |
| InChI | InChI=1S/C27H36O2/c1-3-5-7-9-21-11-12-25-20-24(14-13-23(25)19-21)22-15-17-26(18-16-22)29-27(28)10-8-6-4-2/h13-18,20-21H,3-12,19H2,1-2H3 |
| InChIKey | OLZRSHAXVHOVIB-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.58 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|