C21H22F2 — CID 139853229
7-fluoro-6-(4-fluorophenyl)-2-[(E)-pent-3-enyl]-1,2,3,4-tetrahydronaphthalene (PubChem CID 139853229) has the molecular formula C21H22F2 and a molecular weight of 312.40 g/mol. Its IUPAC name is 7-fluoro-6-(4-fluorophenyl)-2-[(E)-pent-3-enyl]-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 7-fluoro-6-(4-fluorophenyl)-2-[(E)-pent-3-enyl]-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 139853229 |
| Molecular Formula | C21H22F2 |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 7-fluoro-6-(4-fluorophenyl)-2-[(E)-pent-3-enyl]-1,2,3,4-tetrahydronaphthalene |
| SMILES | C/C=C/CCC1CCc2cc(-c3ccc(F)cc3)c(F)cc2C1 |
| InChI | InChI=1S/C21H22F2/c1-2-3-4-5-15-6-7-17-13-20(21(23)14-18(17)12-15)16-8-10-19(22)11-9-16/h2-3,8-11,13-15H,4-7,12H2,1H3/b3-2+ |
| InChIKey | AGTORMRLKNKPCV-NSCUHMNNSA-N |
| XLogP | 6.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|