C28H31F2N — CID 139852942
2,6-difluoro-4-[6-[4-[(E)-pent-3-enyl]cyclohexyl]-5,6,7,8-tetrahydronaphthalen-2-yl]benzonitrile (PubChem CID 139852942) has the molecular formula C28H31F2N and a molecular weight of 419.56 g/mol. Its IUPAC name is 2,6-difluoro-4-[6-[4-[(E)-pent-3-enyl]cyclohexyl]-5,6,7,8-tetrahydronaphthalen-2-yl]benzonitrile.
| Compound Name | 2,6-difluoro-4-[6-[4-[(E)-pent-3-enyl]cyclohexyl]-5,6,7,8-tetrahydronaphthalen-2-yl]benzonitrile |
|---|---|
| PubChem CID | 139852942 |
| Molecular Formula | C28H31F2N |
| Molecular Weight | 419.56 g/mol |
| Exact Mass | 419.24 |
| IUPAC Name | 2,6-difluoro-4-[6-[4-[(E)-pent-3-enyl]cyclohexyl]-5,6,7,8-tetrahydronaphthalen-2-yl]benzonitrile |
| SMILES | C/C=C/CCC1CCC(C2CCc3cc(-c4cc(F)c(C#N)c(F)c4)ccc3C2)CC1 |
| InChI | InChI=1S/C28H31F2N/c1-2-3-4-5-19-6-8-20(9-7-19)21-10-11-23-15-24(13-12-22(23)14-21)25-16-27(29)26(18-31)28(30)17-25/h2-3,12-13,15-17,19-21H,4-11,14H2,1H3/b3-2+ |
| InChIKey | VSTDLVCHWVPTML-NSCUHMNNSA-N |
| XLogP | 7.77 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.56 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|