C26H28F3N — CID 73431359
4-[4-[2,2-difluoro-2-(4-pent-3-enylcyclohexyl)ethyl]phenyl]-2-fluorobenzonitrile (PubChem CID 73431359) has the molecular formula C26H28F3N and a molecular weight of 411.51 g/mol. Its IUPAC name is 4-[4-[2,2-difluoro-2-(4-pent-3-enylcyclohexyl)ethyl]phenyl]-2-fluorobenzonitrile.
| Compound Name | 4-[4-[2,2-difluoro-2-(4-pent-3-enylcyclohexyl)ethyl]phenyl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 73431359 |
| Molecular Formula | C26H28F3N |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | 4-[4-[2,2-difluoro-2-(4-pent-3-enylcyclohexyl)ethyl]phenyl]-2-fluorobenzonitrile |
| SMILES | CC=CCCC1CCC(C(F)(F)Cc2ccc(-c3ccc(C#N)c(F)c3)cc2)CC1 |
| InChI | InChI=1S/C26H28F3N/c1-2-3-4-5-19-8-14-24(15-9-19)26(28,29)17-20-6-10-21(11-7-20)22-12-13-23(18-30)25(27)16-22/h2-3,6-7,10-13,16,19,24H,4-5,8-9,14-15,17H2,1H3 |
| InChIKey | PXJQYUUFMOQWNE-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|