C32H37F4N — CID 18344328
4-[4-[2,2-difluoro-2-[4-[4-[(E)-pent-3-enyl]cyclohexyl]cyclohexyl]ethyl]phenyl]-2,6-difluorobenzonitrile (PubChem CID 18344328) has the molecular formula C32H37F4N and a molecular weight of 511.65 g/mol. Its IUPAC name is 4-[4-[2,2-difluoro-2-[4-[4-[(E)-pent-3-enyl]cyclohexyl]cyclohexyl]ethyl]phenyl]-2,6-difluorobenzonitrile.
| Compound Name | 4-[4-[2,2-difluoro-2-[4-[4-[(E)-pent-3-enyl]cyclohexyl]cyclohexyl]ethyl]phenyl]-2,6-difluorobenzonitrile |
|---|---|
| PubChem CID | 18344328 |
| Molecular Formula | C32H37F4N |
| Molecular Weight | 511.65 g/mol |
| Exact Mass | 511.29 |
| IUPAC Name | 4-[4-[2,2-difluoro-2-[4-[4-[(E)-pent-3-enyl]cyclohexyl]cyclohexyl]ethyl]phenyl]-2,6-difluorobenzonitrile |
| SMILES | C/C=C/CCC1CCC(C2CCC(C(F)(F)Cc3ccc(-c4cc(F)c(C#N)c(F)c4)cc3)CC2)CC1 |
| InChI | InChI=1S/C32H37F4N/c1-2-3-4-5-22-6-10-24(11-7-22)25-14-16-28(17-15-25)32(35,36)20-23-8-12-26(13-9-23)27-18-30(33)29(21-37)31(34)19-27/h2-3,8-9,12-13,18-19,22,24-25,28H,4-7,10-11,14-17,20H2,1H3/b3-2+ |
| InChIKey | KDPZWLNNKCKNAG-NSCUHMNNSA-N |
| XLogP | 9.65 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.65 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|