C26H27F4N — CID 139901585
4-[2-[4-[2,6-difluoro-4-[(E)-pent-3-enyl]phenyl]cyclohexyl]ethyl]-2,6-difluorobenzonitrile (PubChem CID 139901585) has the molecular formula C26H27F4N and a molecular weight of 429.50 g/mol. Its IUPAC name is 4-[2-[4-[2,6-difluoro-4-[(E)-pent-3-enyl]phenyl]cyclohexyl]ethyl]-2,6-difluorobenzonitrile.
| Compound Name | 4-[2-[4-[2,6-difluoro-4-[(E)-pent-3-enyl]phenyl]cyclohexyl]ethyl]-2,6-difluorobenzonitrile |
|---|---|
| PubChem CID | 139901585 |
| Molecular Formula | C26H27F4N |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | 4-[2-[4-[2,6-difluoro-4-[(E)-pent-3-enyl]phenyl]cyclohexyl]ethyl]-2,6-difluorobenzonitrile |
| SMILES | C/C=C/CCc1cc(F)c(C2CCC(CCc3cc(F)c(C#N)c(F)c3)CC2)c(F)c1 |
| InChI | InChI=1S/C26H27F4N/c1-2-3-4-5-18-14-24(29)26(25(30)15-18)20-10-8-17(9-11-20)6-7-19-12-22(27)21(16-31)23(28)13-19/h2-3,12-15,17,20H,4-11H2,1H3/b3-2+ |
| InChIKey | YZKSQRVWZRCFSY-NSCUHMNNSA-N |
| XLogP | 7.53 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|