C26H35F2NO2 — CID 139901522
4-[2-[4-[[4-(2-ethenoxyethyl)cyclohexyl]methoxy]cyclohexyl]ethyl]-2,6-difluorobenzonitrile (PubChem CID 139901522) has the molecular formula C26H35F2NO2 and a molecular weight of 431.57 g/mol. Its IUPAC name is 4-[2-[4-[[4-(2-ethenoxyethyl)cyclohexyl]methoxy]cyclohexyl]ethyl]-2,6-difluorobenzonitrile.
| Compound Name | 4-[2-[4-[[4-(2-ethenoxyethyl)cyclohexyl]methoxy]cyclohexyl]ethyl]-2,6-difluorobenzonitrile |
|---|---|
| PubChem CID | 139901522 |
| Molecular Formula | C26H35F2NO2 |
| Molecular Weight | 431.57 g/mol |
| Exact Mass | 431.26 |
| IUPAC Name | 4-[2-[4-[[4-(2-ethenoxyethyl)cyclohexyl]methoxy]cyclohexyl]ethyl]-2,6-difluorobenzonitrile |
| SMILES | C=COCCC1CCC(COC2CCC(CCc3cc(F)c(C#N)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C26H35F2NO2/c1-2-30-14-13-20-3-6-21(7-4-20)18-31-23-11-9-19(10-12-23)5-8-22-15-25(27)24(17-29)26(28)16-22/h2,15-16,19-21,23H,1,3-14,18H2 |
| InChIKey | YAICDDNHICUOAD-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.57 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|