C25H25F4NO — CID 139901614
4-[4-[2-(4-but-3-enoxy-2,6-difluorophenyl)ethyl]cyclohexyl]-2,6-difluorobenzonitrile (PubChem CID 139901614) has the molecular formula C25H25F4NO and a molecular weight of 431.47 g/mol. Its IUPAC name is 4-[4-[2-(4-but-3-enoxy-2,6-difluorophenyl)ethyl]cyclohexyl]-2,6-difluorobenzonitrile.
| Compound Name | 4-[4-[2-(4-but-3-enoxy-2,6-difluorophenyl)ethyl]cyclohexyl]-2,6-difluorobenzonitrile |
|---|---|
| PubChem CID | 139901614 |
| Molecular Formula | C25H25F4NO |
| Molecular Weight | 431.47 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | 4-[4-[2-(4-but-3-enoxy-2,6-difluorophenyl)ethyl]cyclohexyl]-2,6-difluorobenzonitrile |
| SMILES | C=CCCOc1cc(F)c(CCC2CCC(c3cc(F)c(C#N)c(F)c3)CC2)c(F)c1 |
| InChI | InChI=1S/C25H25F4NO/c1-2-3-10-31-19-13-24(28)20(25(29)14-19)9-6-16-4-7-17(8-5-16)18-11-22(26)21(15-30)23(27)12-18/h2,11-14,16-17H,1,3-10H2 |
| InChIKey | OYRHCKQIGVVIKP-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.47 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|