C27H23F4NO — CID 139901503
4-[2-[4-[2-(4-but-3-enoxyphenyl)ethyl]-2,6-difluorophenyl]ethyl]-2,6-difluorobenzonitrile (PubChem CID 139901503) has the molecular formula C27H23F4NO and a molecular weight of 453.48 g/mol. Its IUPAC name is 4-[2-[4-[2-(4-but-3-enoxyphenyl)ethyl]-2,6-difluorophenyl]ethyl]-2,6-difluorobenzonitrile.
| Compound Name | 4-[2-[4-[2-(4-but-3-enoxyphenyl)ethyl]-2,6-difluorophenyl]ethyl]-2,6-difluorobenzonitrile |
|---|---|
| PubChem CID | 139901503 |
| Molecular Formula | C27H23F4NO |
| Molecular Weight | 453.48 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | 4-[2-[4-[2-(4-but-3-enoxyphenyl)ethyl]-2,6-difluorophenyl]ethyl]-2,6-difluorobenzonitrile |
| SMILES | C=CCCOc1ccc(CCc2cc(F)c(CCc3cc(F)c(C#N)c(F)c3)c(F)c2)cc1 |
| InChI | InChI=1S/C27H23F4NO/c1-2-3-12-33-21-9-6-18(7-10-21)4-5-19-13-24(28)22(25(29)14-19)11-8-20-15-26(30)23(17-32)27(31)16-20/h2,6-7,9-10,13-16H,1,3-5,8,11-12H2 |
| InChIKey | PNUFOADNCSEIOR-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.48 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|