C29H41F2NO — CID 139901554
2,6-difluoro-4-[2-[4-[[4-[(E)-hept-3-enyl]cyclohexyl]oxymethyl]cyclohexyl]ethyl]benzonitrile (PubChem CID 139901554) has the molecular formula C29H41F2NO and a molecular weight of 457.65 g/mol. Its IUPAC name is 2,6-difluoro-4-[2-[4-[[4-[(E)-hept-3-enyl]cyclohexyl]oxymethyl]cyclohexyl]ethyl]benzonitrile.
| Compound Name | 2,6-difluoro-4-[2-[4-[[4-[(E)-hept-3-enyl]cyclohexyl]oxymethyl]cyclohexyl]ethyl]benzonitrile |
|---|---|
| PubChem CID | 139901554 |
| Molecular Formula | C29H41F2NO |
| Molecular Weight | 457.65 g/mol |
| Exact Mass | 457.32 |
| IUPAC Name | 2,6-difluoro-4-[2-[4-[[4-[(E)-hept-3-enyl]cyclohexyl]oxymethyl]cyclohexyl]ethyl]benzonitrile |
| SMILES | CCC/C=C/CCC1CCC(OCC2CCC(CCc3cc(F)c(C#N)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C29H41F2NO/c1-2-3-4-5-6-7-22-14-16-26(17-15-22)33-21-24-11-8-23(9-12-24)10-13-25-18-28(30)27(20-32)29(31)19-25/h4-5,18-19,22-24,26H,2-3,6-17,21H2,1H3/b5-4+ |
| InChIKey | JNOCSKLSZAKMOE-SNAWJCMRSA-N |
| XLogP | 8.29 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.65 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|