C18H20INO3 — CID 118358562
(6-butoxy-1,2,3,4-tetrahydronaphthalen-2-yl)-(5-iodo-1,3-oxazol-2-yl)methanone (PubChem CID 118358562) has the molecular formula C18H20INO3 and a molecular weight of 425.27 g/mol. Its IUPAC name is (6-butoxy-1,2,3,4-tetrahydronaphthalen-2-yl)-(5-iodo-1,3-oxazol-2-yl)methanone.
| Compound Name | (6-butoxy-1,2,3,4-tetrahydronaphthalen-2-yl)-(5-iodo-1,3-oxazol-2-yl)methanone |
|---|---|
| PubChem CID | 118358562 |
| Molecular Formula | C18H20INO3 |
| Molecular Weight | 425.27 g/mol |
| Exact Mass | 425.05 |
| IUPAC Name | (6-butoxy-1,2,3,4-tetrahydronaphthalen-2-yl)-(5-iodo-1,3-oxazol-2-yl)methanone |
| SMILES | CCCCOc1ccc2c(c1)CCC(C(=O)c1ncc(I)o1)C2 |
| InChI | InChI=1S/C18H20INO3/c1-2-3-8-22-15-7-6-12-9-14(5-4-13(12)10-15)17(21)18-20-11-16(19)23-18/h6-7,10-11,14H,2-5,8-9H2,1H3 |
| InChIKey | RLHBXKLFIGKRRA-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.27 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|