C15H23NO — CID 129390519
(2S)-N-ethyl-6-propoxy-1,2,3,4-tetrahydronaphthalen-2-amine (PubChem CID 129390519) has the molecular formula C15H23NO and a molecular weight of 233.35 g/mol. Its IUPAC name is (2S)-N-ethyl-6-propoxy-1,2,3,4-tetrahydronaphthalen-2-amine.
| Compound Name | (2S)-N-ethyl-6-propoxy-1,2,3,4-tetrahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 129390519 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | (2S)-N-ethyl-6-propoxy-1,2,3,4-tetrahydronaphthalen-2-amine |
| SMILES | CCCOc1ccc2c(c1)CC[C@H](NCC)C2 |
| InChI | InChI=1S/C15H23NO/c1-3-9-17-15-8-6-12-10-14(16-4-2)7-5-13(12)11-15/h6,8,11,14,16H,3-5,7,9-10H2,1-2H3/t14-/m0/s1 |
| InChIKey | YGLUGOOAICUITE-AWEZNQCLSA-N |
| XLogP | 2.94 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |