C17H27NO — CID 115572613
N-(3-butoxypropyl)-1,2,3,4-tetrahydronaphthalen-2-amine (PubChem CID 115572613) has the molecular formula C17H27NO and a molecular weight of 261.41 g/mol. Its IUPAC name is N-(3-butoxypropyl)-1,2,3,4-tetrahydronaphthalen-2-amine.
| Compound Name | N-(3-butoxypropyl)-1,2,3,4-tetrahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 115572613 |
| Molecular Formula | C17H27NO |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.21 |
| IUPAC Name | N-(3-butoxypropyl)-1,2,3,4-tetrahydronaphthalen-2-amine |
| SMILES | CCCCOCCCNC1CCc2ccccc2C1 |
| InChI | InChI=1S/C17H27NO/c1-2-3-12-19-13-6-11-18-17-10-9-15-7-4-5-8-16(15)14-17/h4-5,7-8,17-18H,2-3,6,9-14H2,1H3 |
| InChIKey | BZAPGIPJTSQZLH-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|