C15H23NO2 — CID 43512948
N-[3-(2-methoxyethoxy)propyl]-2,3-dihydro-1H-inden-2-amine (PubChem CID 43512948) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is N-[3-(2-methoxyethoxy)propyl]-2,3-dihydro-1H-inden-2-amine.
| Compound Name | N-[3-(2-methoxyethoxy)propyl]-2,3-dihydro-1H-inden-2-amine |
|---|---|
| PubChem CID | 43512948 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | N-[3-(2-methoxyethoxy)propyl]-2,3-dihydro-1H-inden-2-amine |
| SMILES | COCCOCCCNC1Cc2ccccc2C1 |
| InChI | InChI=1S/C15H23NO2/c1-17-9-10-18-8-4-7-16-15-11-13-5-2-3-6-14(13)12-15/h2-3,5-6,15-16H,4,7-12H2,1H3 |
| InChIKey | UCIKEARTANGKDV-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|